Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A10583 | Purity: >98% |
 | |
| Chemical structure of pan-KRAS degrader 1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2937327-83-6 |
|---|---|
| Purity | >98% |
| Formula | C22H26N8OS |
| Mol Weight | 450.56 |
| CoA | CoA of pan-KRAS degrader 1 |
| Smiles: | C[C@]1(C2=C(SC(N)=C2C#N)CCC1)C3=NC(=NO3)C4=NC(=NC=C4)N5[C@@H](C)CNCCC5 |
|---|
KEYWORDS: buy pan-KRAS degrader 1 | pan-KRAS degrader 1 supplier | purchase | cost | manufacturer | order | distributor | buy 2937327-83-6 | 2937327-83-6 supplier